C26H33F2N5O2 — CID 87440682
4-[[1-(cyanoamino)-2-[4-(2,4-difluorophenyl)piperazin-1-yl]-2-methylpropylidene]amino]adamantane-1-carboxylic acid (PubChem CID 87440682) has the molecular formula C26H33F2N5O2 and a molecular weight of 485.58 g/mol. Its IUPAC name is 4-[[1-(cyanoamino)-2-[4-(2,4-difluorophenyl)piperazin-1-yl]-2-methylpropylidene]amino]adamantane-1-carboxylic acid.
| Compound Name | 4-[[1-(cyanoamino)-2-[4-(2,4-difluorophenyl)piperazin-1-yl]-2-methylpropylidene]amino]adamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 87440682 |
| Molecular Formula | C26H33F2N5O2 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | 4-[[1-(cyanoamino)-2-[4-(2,4-difluorophenyl)piperazin-1-yl]-2-methylpropylidene]amino]adamantane-1-carboxylic acid |
| SMILES | CC(C)(/C(=N/C1C2CC3CC1CC(C(=O)O)(C3)C2)NC#N)N1CCN(c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C26H33F2N5O2/c1-25(2,33-7-5-32(6-8-33)21-4-3-19(27)11-20(21)28)23(30-15-29)31-22-17-9-16-10-18(22)14-26(12-16,13-17)24(34)35/h3-4,11,16-18,22H,5-10,12-14H2,1-2H3,(H,30,31)(H,34,35) |
| InChIKey | APHNIVKRYMQXOZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 91.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|