About N-cyano-N'-(5-hydroxy-2-adamantyl)-2-(4-hydroxypiperidin-1-yl)propanimidamide
N-cyano-N'-(5-hydroxy-2-adamantyl)-2-(4-hydroxypiperidin-1-yl)propanimidamide (PubChem CID 87440737) has the molecular formula C19H30N4O2
and a molecular weight of 346.48 g/mol. Its IUPAC name is N-cyano-N'-(5-hydroxy-2-adamantyl)-2-(4-hydroxypiperidin-1-yl)propanimidamide.
Molecular Properties
| Compound Name | N-cyano-N'-(5-hydroxy-2-adamantyl)-2-(4-hydroxypiperidin-1-yl)propanimidamide |
| PubChem CID | 87440737 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | N-cyano-N'-(5-hydroxy-2-adamantyl)-2-(4-hydroxypiperidin-1-yl)propanimidamide |
| SMILES | CC(/C(=N/C1C2CC3CC1CC(O)(C3)C2)NC#N)N1CCC(O)CC1 |
| InChI | InChI=1S/C19H30N4O2/c1-12(23-4-2-16(24)3-5-23)18(21-11-20)22-17-14-6-13-7-15(17)10-19(25,8-13)9-14/h12-17,24-25H,2-10H2,1H3,(H,21,22) |
| InChIKey | XMYICMYVMBSQFS-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 91.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-cyano-N'-(5-hydroxy-2-adamantyl)-2-(4-hydroxypiperidin-1-yl)propanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyano-N'-(5-hydroxy-2-adamantyl)-2-(4-hydroxypiperidin-1-yl)propanimidamide?
The IUPAC name of N-cyano-N'-(5-hydroxy-2-adamantyl)-2-(4-hydroxypiperidin-1-yl)propanimidamide (CID 87440737) is N-cyano-N'-(5-hydroxy-2-adamantyl)-2-(4-hydroxypiperidin-1-yl)propanimidamide.
What is the SMILES notation for N-cyano-N'-(5-hydroxy-2-adamantyl)-2-(4-hydroxypiperidin-1-yl)propanimidamide?
The canonical SMILES for N-cyano-N'-(5-hydroxy-2-adamantyl)-2-(4-hydroxypiperidin-1-yl)propanimidamide is CC(/C(=N/C1C2CC3CC1CC(O)(C3)C2)NC#N)N1CCC(O)CC1.
What is the InChIKey of N-cyano-N'-(5-hydroxy-2-adamantyl)-2-(4-hydroxypiperidin-1-yl)propanimidamide?
The InChIKey is XMYICMYVMBSQFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30N4O2/c1-12(23-4-2-16(24)3-5-23)18(21-11-20)22-17-14-6-13-7-15(17)10-19(25,8-13)9-14/h12-17,24-25H,2-10H2,1H3,(H,21,22).
What are the key properties of N-cyano-N'-(5-hydroxy-2-adamantyl)-2-(4-hydroxypiperidin-1-yl)propanimidamide?
N-cyano-N'-(5-hydroxy-2-adamantyl)-2-(4-hydroxypiperidin-1-yl)propanimidamide has a molecular weight of 346.48 g/mol, XLogP of 1.24, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyano-N'-(5-hydroxy-2-adamantyl)-2-(4-hydroxypiperidin-1-yl)propanimidamide is sourced from PubChem (CID 87440737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).