C29H26N2O2P+ — CID 87440786
(5-ethoxycarbonylimidazo[1,2-a]pyridin-2-yl)methyl-triphenylphosphanium (PubChem CID 87440786) has the molecular formula C29H26N2O2P+ and a molecular weight of 465.51 g/mol. Its IUPAC name is (5-ethoxycarbonylimidazo[1,2-a]pyridin-2-yl)methyl-triphenylphosphanium.
| Compound Name | (5-ethoxycarbonylimidazo[1,2-a]pyridin-2-yl)methyl-triphenylphosphanium |
|---|---|
| PubChem CID | 87440786 |
| Molecular Formula | C29H26N2O2P+ |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | (5-ethoxycarbonylimidazo[1,2-a]pyridin-2-yl)methyl-triphenylphosphanium |
| SMILES | CCOC(=O)c1cccc2nc(C[P+](c3ccccc3)(c3ccccc3)c3ccccc3)cn12 |
| InChI | InChI=1S/C29H26N2O2P/c1-2-33-29(32)27-19-12-20-28-30-23(21-31(27)28)22-34(24-13-6-3-7-14-24,25-15-8-4-9-16-25)26-17-10-5-11-18-26/h3-21H,2,22H2,1H3/q+1 |
| InChIKey | HGWXHSHYJHEAPV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|