About [5-(4-fluoroanilino)-2-methyl-1,3-thiazol-4-yl] N-(2-chloro-4-pyridinyl)carbamate
[5-(4-fluoroanilino)-2-methyl-1,3-thiazol-4-yl] N-(2-chloro-4-pyridinyl)carbamate (PubChem CID 87440928) has the molecular formula C16H12ClFN4O2S
and a molecular weight of 378.82 g/mol. Its IUPAC name is [5-(4-fluoroanilino)-2-methyl-1,3-thiazol-4-yl] N-(2-chloro-4-pyridinyl)carbamate.
Molecular Properties
| Compound Name | [5-(4-fluoroanilino)-2-methyl-1,3-thiazol-4-yl] N-(2-chloro-4-pyridinyl)carbamate |
| PubChem CID | 87440928 |
| Molecular Formula | C16H12ClFN4O2S |
| Molecular Weight | 378.82 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | [5-(4-fluoroanilino)-2-methyl-1,3-thiazol-4-yl] N-(2-chloro-4-pyridinyl)carbamate |
| SMILES | Cc1nc(OC(=O)Nc2ccnc(Cl)c2)c(Nc2ccc(F)cc2)s1 |
| InChI | InChI=1S/C16H12ClFN4O2S/c1-9-20-14(15(25-9)21-11-4-2-10(18)3-5-11)24-16(23)22-12-6-7-19-13(17)8-12/h2-8,21H,1H3,(H,19,22,23) |
| InChIKey | SVRNDWUUKGECJU-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.82 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze [5-(4-fluoroanilino)-2-methyl-1,3-thiazol-4-yl] N-(2-chloro-4-pyridinyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(4-fluoroanilino)-2-methyl-1,3-thiazol-4-yl] N-(2-chloro-4-pyridinyl)carbamate?
The IUPAC name of [5-(4-fluoroanilino)-2-methyl-1,3-thiazol-4-yl] N-(2-chloro-4-pyridinyl)carbamate (CID 87440928) is [5-(4-fluoroanilino)-2-methyl-1,3-thiazol-4-yl] N-(2-chloro-4-pyridinyl)carbamate.
What is the SMILES notation for [5-(4-fluoroanilino)-2-methyl-1,3-thiazol-4-yl] N-(2-chloro-4-pyridinyl)carbamate?
The canonical SMILES for [5-(4-fluoroanilino)-2-methyl-1,3-thiazol-4-yl] N-(2-chloro-4-pyridinyl)carbamate is Cc1nc(OC(=O)Nc2ccnc(Cl)c2)c(Nc2ccc(F)cc2)s1.
What is the InChIKey of [5-(4-fluoroanilino)-2-methyl-1,3-thiazol-4-yl] N-(2-chloro-4-pyridinyl)carbamate?
The InChIKey is SVRNDWUUKGECJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12ClFN4O2S/c1-9-20-14(15(25-9)21-11-4-2-10(18)3-5-11)24-16(23)22-12-6-7-19-13(17)8-12/h2-8,21H,1H3,(H,19,22,23).
What are the key properties of [5-(4-fluoroanilino)-2-methyl-1,3-thiazol-4-yl] N-(2-chloro-4-pyridinyl)carbamate?
[5-(4-fluoroanilino)-2-methyl-1,3-thiazol-4-yl] N-(2-chloro-4-pyridinyl)carbamate has a molecular weight of 378.82 g/mol, XLogP of 4.99, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(4-fluoroanilino)-2-methyl-1,3-thiazol-4-yl] N-(2-chloro-4-pyridinyl)carbamate is sourced from PubChem (CID 87440928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).