C25H34F2N6OS — CID 87441199
4-[[1-(cyanoamino)-2-(3,3-difluoropiperidin-1-yl)-2-methylpropylidene]amino]-N-(1,3-thiazol-5-ylmethyl)adamantane-1-carboxamide (PubChem CID 87441199) has the molecular formula C25H34F2N6OS and a molecular weight of 504.65 g/mol. Its IUPAC name is 4-[[1-(cyanoamino)-2-(3,3-difluoropiperidin-1-yl)-2-methylpropylidene]amino]-N-(1,3-thiazol-5-ylmethyl)adamantane-1-carboxamide.
| Compound Name | 4-[[1-(cyanoamino)-2-(3,3-difluoropiperidin-1-yl)-2-methylpropylidene]amino]-N-(1,3-thiazol-5-ylmethyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 87441199 |
| Molecular Formula | C25H34F2N6OS |
| Molecular Weight | 504.65 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | 4-[[1-(cyanoamino)-2-(3,3-difluoropiperidin-1-yl)-2-methylpropylidene]amino]-N-(1,3-thiazol-5-ylmethyl)adamantane-1-carboxamide |
| SMILES | CC(C)(/C(=N/C1C2CC3CC1CC(C(=O)NCc1cncs1)(C3)C2)NC#N)N1CCCC(F)(F)C1 |
| InChI | InChI=1S/C25H34F2N6OS/c1-23(2,33-5-3-4-25(26,27)13-33)21(31-14-28)32-20-17-6-16-7-18(20)10-24(8-16,9-17)22(34)30-12-19-11-29-15-35-19/h11,15-18,20H,3-10,12-13H2,1-2H3,(H,30,34)(H,31,32) |
| InChIKey | LGGGTKXYZGFFDH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 93.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.65 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|