C21H25N3 — CID 87441337
N'-(2-adamantyl)-N-cyano-1-phenylcyclopropane-1-carboximidamide (PubChem CID 87441337) has the molecular formula C21H25N3 and a molecular weight of 319.45 g/mol. Its IUPAC name is N'-(2-adamantyl)-N-cyano-1-phenylcyclopropane-1-carboximidamide.
| Compound Name | N'-(2-adamantyl)-N-cyano-1-phenylcyclopropane-1-carboximidamide |
|---|---|
| PubChem CID | 87441337 |
| Molecular Formula | C21H25N3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | N'-(2-adamantyl)-N-cyano-1-phenylcyclopropane-1-carboximidamide |
| SMILES | N#CN/C(=N\C1C2CC3CC(C2)CC1C3)C1(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H25N3/c22-13-23-20(21(6-7-21)18-4-2-1-3-5-18)24-19-16-9-14-8-15(11-16)12-17(19)10-14/h1-5,14-17,19H,6-12H2,(H,23,24) |
| InChIKey | LEPRPRMBDGGZDQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|