C26H34N4O2 — CID 87441432
4-[[1-(cyanoamino)-2-methyl-2-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)propylidene]amino]adamantane-1-carboxylic acid (PubChem CID 87441432) has the molecular formula C26H34N4O2 and a molecular weight of 434.58 g/mol. Its IUPAC name is 4-[[1-(cyanoamino)-2-methyl-2-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)propylidene]amino]adamantane-1-carboxylic acid.
| Compound Name | 4-[[1-(cyanoamino)-2-methyl-2-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)propylidene]amino]adamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 87441432 |
| Molecular Formula | C26H34N4O2 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | 4-[[1-(cyanoamino)-2-methyl-2-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)propylidene]amino]adamantane-1-carboxylic acid |
| SMILES | CC(C)(/C(=N/C1C2CC3CC1CC(C(=O)O)(C3)C2)NC#N)N1CCc2ccccc2CC1 |
| InChI | InChI=1S/C26H34N4O2/c1-25(2,30-9-7-18-5-3-4-6-19(18)8-10-30)23(28-16-27)29-22-20-11-17-12-21(22)15-26(13-17,14-20)24(31)32/h3-6,17,20-22H,7-15H2,1-2H3,(H,28,29)(H,31,32) |
| InChIKey | VZJUCGSJQIPHNR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 88.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|