C29H38F3N5O2 — CID 87441520
4-[[1-(cyanoamino)-2-methyl-2-[5-[3-(trifluoromethyl)phenyl]-1,5-diazocan-1-yl]propylidene]amino]adamantane-1-carboxylic acid (PubChem CID 87441520) has the molecular formula C29H38F3N5O2 and a molecular weight of 545.65 g/mol. Its IUPAC name is 4-[[1-(cyanoamino)-2-methyl-2-[5-[3-(trifluoromethyl)phenyl]-1,5-diazocan-1-yl]propylidene]amino]adamantane-1-carboxylic acid.
| Compound Name | 4-[[1-(cyanoamino)-2-methyl-2-[5-[3-(trifluoromethyl)phenyl]-1,5-diazocan-1-yl]propylidene]amino]adamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 87441520 |
| Molecular Formula | C29H38F3N5O2 |
| Molecular Weight | 545.65 g/mol |
| Exact Mass | 545.30 |
| IUPAC Name | 4-[[1-(cyanoamino)-2-methyl-2-[5-[3-(trifluoromethyl)phenyl]-1,5-diazocan-1-yl]propylidene]amino]adamantane-1-carboxylic acid |
| SMILES | CC(C)(/C(=N/C1C2CC3CC1CC(C(=O)O)(C3)C2)NC#N)N1CCCN(c2cccc(C(F)(F)F)c2)CCC1 |
| InChI | InChI=1S/C29H38F3N5O2/c1-27(2,37-10-4-8-36(9-5-11-37)23-7-3-6-22(14-23)29(30,31)32)25(34-18-33)35-24-20-12-19-13-21(24)17-28(15-19,16-20)26(38)39/h3,6-7,14,19-21,24H,4-5,8-13,15-17H2,1-2H3,(H,34,35)(H,38,39) |
| InChIKey | JRHNIPGXKLYCJF-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 91.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.65 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|