C31H43F3O4 — CID 87441548
5,7-ditert-butyl-3-hydroxy-3-(trifluoromethyl)-1-benzofuran-2-one;2,4-ditert-butylphenol (PubChem CID 87441548) has the molecular formula C31H43F3O4 and a molecular weight of 536.68 g/mol. Its IUPAC name is 5,7-ditert-butyl-3-hydroxy-3-(trifluoromethyl)-1-benzofuran-2-one;2,4-ditert-butylphenol.
| Compound Name | 5,7-ditert-butyl-3-hydroxy-3-(trifluoromethyl)-1-benzofuran-2-one;2,4-ditert-butylphenol |
|---|---|
| PubChem CID | 87441548 |
| Molecular Formula | C31H43F3O4 |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.31 |
| IUPAC Name | 5,7-ditert-butyl-3-hydroxy-3-(trifluoromethyl)-1-benzofuran-2-one;2,4-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2c(c1)C(O)(C(F)(F)F)C(=O)O2.CC(C)(C)c1ccc(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C17H21F3O3.C14H22O/c1-14(2,3)9-7-10(15(4,5)6)12-11(8-9)16(22,13(21)23-12)17(18,19)20;1-13(2,3)10-7-8-12(15)11(9-10)14(4,5)6/h7-8,22H,1-6H3;7-9,15H,1-6H3 |
| InChIKey | YEXAORWKAQNUTE-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|