C7H9F4NO — CID 87441714
2-methyl-N-(1,3,3,3-tetrafluoropropyl)prop-2-enamide (PubChem CID 87441714) has the molecular formula C7H9F4NO and a molecular weight of 199.15 g/mol. Its IUPAC name is 2-methyl-N-(1,3,3,3-tetrafluoropropyl)prop-2-enamide.
| Compound Name | 2-methyl-N-(1,3,3,3-tetrafluoropropyl)prop-2-enamide |
|---|---|
| PubChem CID | 87441714 |
| Molecular Formula | C7H9F4NO |
| Molecular Weight | 199.15 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 2-methyl-N-(1,3,3,3-tetrafluoropropyl)prop-2-enamide |
| SMILES | C=C(C)C(=O)NC(F)CC(F)(F)F |
| InChI | InChI=1S/C7H9F4NO/c1-4(2)6(13)12-5(8)3-7(9,10)11/h5H,1,3H2,2H3,(H,12,13) |
| InChIKey | QXNSWGHSYNHRAT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.15 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|