C18H22ClN3O — CID 87441722
N-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]-2-(4-chlorophenoxy)-N-cyano-2-methylpropanimidamide (PubChem CID 87441722) has the molecular formula C18H22ClN3O and a molecular weight of 331.85 g/mol. Its IUPAC name is N-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]-2-(4-chlorophenoxy)-N-cyano-2-methylpropanimidamide.
| Compound Name | N-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]-2-(4-chlorophenoxy)-N-cyano-2-methylpropanimidamide |
|---|---|
| PubChem CID | 87441722 |
| Molecular Formula | C18H22ClN3O |
| Molecular Weight | 331.85 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | N-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]-2-(4-chlorophenoxy)-N-cyano-2-methylpropanimidamide |
| SMILES | [H]/N=C(/N(C#N)[C@H]1C[C@@H]2CC[C@H]1C2)C(C)(C)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H22ClN3O/c1-18(2,23-15-7-5-14(19)6-8-15)17(21)22(11-20)16-10-12-3-4-13(16)9-12/h5-8,12-13,16,21H,3-4,9-10H2,1-2H3/b21-17+/t12-,13+,16+/m1/s1 |
| InChIKey | UHARPHOWGDNZQB-KTPYVKSDSA-N |
| XLogP | 4.45 |
| TPSA | 60.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.85 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|