C42H58O2 — CID 87442185
3-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-18-(3-ethoxy-2,6,6-trimethylcyclohexen-1-yl)-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-2,4,4-trimethylcyclohex-2-en-1-one (PubChem CID 87442185) has the molecular formula C42H58O2 and a molecular weight of 594.92 g/mol. Its IUPAC name is 3-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-18-(3-ethoxy-2,6,6-trimethylcyclohexen-1-yl)-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-2,4,4-trimethylcyclohex-2-en-1-one.
| Compound Name | 3-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-18-(3-ethoxy-2,6,6-trimethylcyclohexen-1-yl)-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-2,4,4-trimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 87442185 |
| Molecular Formula | C42H58O2 |
| Molecular Weight | 594.92 g/mol |
| Exact Mass | 594.44 |
| IUPAC Name | 3-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-18-(3-ethoxy-2,6,6-trimethylcyclohexen-1-yl)-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-2,4,4-trimethylcyclohex-2-en-1-one |
| SMILES | CCOC1CCC(C)(C)C(/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C2=C(C)C(=O)CCC2(C)C)=C1C |
| InChI | InChI=1S/C42H58O2/c1-12-44-40-28-30-42(10,11)38(36(40)7)26-24-34(5)22-16-20-32(3)18-14-13-17-31(2)19-15-21-33(4)23-25-37-35(6)39(43)27-29-41(37,8)9/h13-26,40H,12,27-30H2,1-11H3/b14-13+,19-15+,20-16+,25-23+,26-24+,31-17+,32-18+,33-21+,34-22+ |
| InChIKey | VBRPGRIUDTVNFF-HOEKICHESA-N |
| XLogP | 11.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.92 |
| LogP ≤ 5 | 11.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|