C40H60O2 — CID 87442432
4-[(3E,5E,7E,9E,11E,13E,15E)-18-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-3,7,12,16-tetramethyloctadeca-3,5,7,9,11,13,15-heptaenyl]-3,5,5-trimethylcyclohex-3-en-1-ol (PubChem CID 87442432) has the molecular formula C40H60O2 and a molecular weight of 572.92 g/mol. Its IUPAC name is 4-[(3E,5E,7E,9E,11E,13E,15E)-18-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-3,7,12,16-tetramethyloctadeca-3,5,7,9,11,13,15-heptaenyl]-3,5,5-trimethylcyclohex-3-en-1-ol.
| Compound Name | 4-[(3E,5E,7E,9E,11E,13E,15E)-18-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-3,7,12,16-tetramethyloctadeca-3,5,7,9,11,13,15-heptaenyl]-3,5,5-trimethylcyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 87442432 |
| Molecular Formula | C40H60O2 |
| Molecular Weight | 572.92 g/mol |
| Exact Mass | 572.46 |
| IUPAC Name | 4-[(3E,5E,7E,9E,11E,13E,15E)-18-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-3,7,12,16-tetramethyloctadeca-3,5,7,9,11,13,15-heptaenyl]-3,5,5-trimethylcyclohex-3-en-1-ol |
| SMILES | CC1=C(CC/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(\C)CCC2=C(C)CC(O)CC2(C)C)C(C)(C)CC(O)C1 |
| InChI | InChI=1S/C40H60O2/c1-29(17-13-19-31(3)21-23-37-33(5)25-35(41)27-39(37,7)8)15-11-12-16-30(2)18-14-20-32(4)22-24-38-34(6)26-36(42)28-40(38,9)10/h11-20,35-36,41-42H,21-28H2,1-10H3/b12-11+,17-13+,18-14+,29-15+,30-16+,31-19+,32-20+ |
| InChIKey | DCNLLBVWQNTIMR-PJQROKOUSA-N |
| XLogP | 11.00 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.92 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|