C50H82O4 — CID 87442463
2-[6-[4-[2-[3,5-bis(2-methylbutan-2-yl)-4-[4-(oxiran-2-yl)hexoxy]phenyl]ethyl]-2,6-bis(2-methylbutan-2-yl)phenoxy]hexan-3-yl]oxirane (PubChem CID 87442463) has the molecular formula C50H82O4 and a molecular weight of 747.20 g/mol. Its IUPAC name is 2-[6-[4-[2-[3,5-bis(2-methylbutan-2-yl)-4-[4-(oxiran-2-yl)hexoxy]phenyl]ethyl]-2,6-bis(2-methylbutan-2-yl)phenoxy]hexan-3-yl]oxirane.
| Compound Name | 2-[6-[4-[2-[3,5-bis(2-methylbutan-2-yl)-4-[4-(oxiran-2-yl)hexoxy]phenyl]ethyl]-2,6-bis(2-methylbutan-2-yl)phenoxy]hexan-3-yl]oxirane |
|---|---|
| PubChem CID | 87442463 |
| Molecular Formula | C50H82O4 |
| Molecular Weight | 747.20 g/mol |
| Exact Mass | 746.62 |
| IUPAC Name | 2-[6-[4-[2-[3,5-bis(2-methylbutan-2-yl)-4-[4-(oxiran-2-yl)hexoxy]phenyl]ethyl]-2,6-bis(2-methylbutan-2-yl)phenoxy]hexan-3-yl]oxirane |
| SMILES | CCC(CCCOc1c(C(C)(C)CC)cc(CCc2cc(C(C)(C)CC)c(OCCCC(CC)C3CO3)c(C(C)(C)CC)c2)cc1C(C)(C)CC)C1CO1 |
| InChI | InChI=1S/C50H82O4/c1-15-37(43-33-53-43)23-21-27-51-45-39(47(7,8)17-3)29-35(30-40(45)48(9,10)18-4)25-26-36-31-41(49(11,12)19-5)46(42(32-36)50(13,14)20-6)52-28-22-24-38(16-2)44-34-54-44/h29-32,37-38,43-44H,15-28,33-34H2,1-14H3 |
| InChIKey | PGQSVWBZGUFRHF-UHFFFAOYSA-N |
| XLogP | 13.39 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.20 |
| LogP ≤ 5 | 13.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|