C41H64O4 — CID 87442484
2-[1-[2,6-ditert-butyl-4-[2-[3,5-ditert-butyl-4-[1-(oxiran-2-yl)propoxy]phenyl]propan-2-yl]phenoxy]propyl]oxirane (PubChem CID 87442484) has the molecular formula C41H64O4 and a molecular weight of 620.96 g/mol. Its IUPAC name is 2-[1-[2,6-ditert-butyl-4-[2-[3,5-ditert-butyl-4-[1-(oxiran-2-yl)propoxy]phenyl]propan-2-yl]phenoxy]propyl]oxirane.
| Compound Name | 2-[1-[2,6-ditert-butyl-4-[2-[3,5-ditert-butyl-4-[1-(oxiran-2-yl)propoxy]phenyl]propan-2-yl]phenoxy]propyl]oxirane |
|---|---|
| PubChem CID | 87442484 |
| Molecular Formula | C41H64O4 |
| Molecular Weight | 620.96 g/mol |
| Exact Mass | 620.48 |
| IUPAC Name | 2-[1-[2,6-ditert-butyl-4-[2-[3,5-ditert-butyl-4-[1-(oxiran-2-yl)propoxy]phenyl]propan-2-yl]phenoxy]propyl]oxirane |
| SMILES | CCC(Oc1c(C(C)(C)C)cc(C(C)(C)c2cc(C(C)(C)C)c(OC(CC)C3CO3)c(C(C)(C)C)c2)cc1C(C)(C)C)C1CO1 |
| InChI | InChI=1S/C41H64O4/c1-17-31(33-23-42-33)44-35-27(37(3,4)5)19-25(20-28(35)38(6,7)8)41(15,16)26-21-29(39(9,10)11)36(30(22-26)40(12,13)14)45-32(18-2)34-24-43-34/h19-22,31-34H,17-18,23-24H2,1-16H3 |
| InChIKey | PRFDUQJFAKVNHX-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.96 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|