C34H50O4 — CID 87442497
2-[3-[4-[4-[3-(oxiran-2-yl)propoxy]-3,5-di(propan-2-yl)phenyl]-2,6-di(propan-2-yl)phenoxy]propyl]oxirane (PubChem CID 87442497) has the molecular formula C34H50O4 and a molecular weight of 522.77 g/mol. Its IUPAC name is 2-[3-[4-[4-[3-(oxiran-2-yl)propoxy]-3,5-di(propan-2-yl)phenyl]-2,6-di(propan-2-yl)phenoxy]propyl]oxirane.
| Compound Name | 2-[3-[4-[4-[3-(oxiran-2-yl)propoxy]-3,5-di(propan-2-yl)phenyl]-2,6-di(propan-2-yl)phenoxy]propyl]oxirane |
|---|---|
| PubChem CID | 87442497 |
| Molecular Formula | C34H50O4 |
| Molecular Weight | 522.77 g/mol |
| Exact Mass | 522.37 |
| IUPAC Name | 2-[3-[4-[4-[3-(oxiran-2-yl)propoxy]-3,5-di(propan-2-yl)phenyl]-2,6-di(propan-2-yl)phenoxy]propyl]oxirane |
| SMILES | CC(C)c1cc(-c2cc(C(C)C)c(OCCCC3CO3)c(C(C)C)c2)cc(C(C)C)c1OCCCC1CO1 |
| InChI | InChI=1S/C34H50O4/c1-21(2)29-15-25(16-30(22(3)4)33(29)35-13-9-11-27-19-37-27)26-17-31(23(5)6)34(32(18-26)24(7)8)36-14-10-12-28-20-38-28/h15-18,21-24,27-28H,9-14,19-20H2,1-8H3 |
| InChIKey | VIMPLAYDFWRNJV-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.77 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|