C52H86O4 — CID 87442705
2-[2-[4-[3,5-bis(2-methylheptan-2-yl)-4-[2-(oxiran-2-yl)ethoxy]phenyl]-2,6-bis(2-methylheptan-2-yl)phenoxy]ethyl]oxirane (PubChem CID 87442705) has the molecular formula C52H86O4 and a molecular weight of 775.26 g/mol. Its IUPAC name is 2-[2-[4-[3,5-bis(2-methylheptan-2-yl)-4-[2-(oxiran-2-yl)ethoxy]phenyl]-2,6-bis(2-methylheptan-2-yl)phenoxy]ethyl]oxirane.
| Compound Name | 2-[2-[4-[3,5-bis(2-methylheptan-2-yl)-4-[2-(oxiran-2-yl)ethoxy]phenyl]-2,6-bis(2-methylheptan-2-yl)phenoxy]ethyl]oxirane |
|---|---|
| PubChem CID | 87442705 |
| Molecular Formula | C52H86O4 |
| Molecular Weight | 775.26 g/mol |
| Exact Mass | 774.65 |
| IUPAC Name | 2-[2-[4-[3,5-bis(2-methylheptan-2-yl)-4-[2-(oxiran-2-yl)ethoxy]phenyl]-2,6-bis(2-methylheptan-2-yl)phenoxy]ethyl]oxirane |
| SMILES | CCCCCC(C)(C)c1cc(-c2cc(C(C)(C)CCCCC)c(OCCC3CO3)c(C(C)(C)CCCCC)c2)cc(C(C)(C)CCCCC)c1OCCC1CO1 |
| InChI | InChI=1S/C52H86O4/c1-13-17-21-27-49(5,6)43-33-39(34-44(50(7,8)28-22-18-14-2)47(43)53-31-25-41-37-55-41)40-35-45(51(9,10)29-23-19-15-3)48(54-32-26-42-38-56-42)46(36-40)52(11,12)30-24-20-16-4/h33-36,41-42H,13-32,37-38H2,1-12H3 |
| InChIKey | GECVZFFCYPXUNQ-UHFFFAOYSA-N |
| XLogP | 15.12 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.26 |
| LogP ≤ 5 | 15.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|