C15H11ClN6S2 — CID 87443078
4-(2-amino-4-methyl-1,3-thiazol-5-yl)-N-(4-chloroanilino)-1,3-thiazole-2-carboximidoyl cyanide (PubChem CID 87443078) has the molecular formula C15H11ClN6S2 and a molecular weight of 374.88 g/mol. Its IUPAC name is 4-(2-amino-4-methyl-1,3-thiazol-5-yl)-N-(4-chloroanilino)-1,3-thiazole-2-carboximidoyl cyanide.
| Compound Name | 4-(2-amino-4-methyl-1,3-thiazol-5-yl)-N-(4-chloroanilino)-1,3-thiazole-2-carboximidoyl cyanide |
|---|---|
| PubChem CID | 87443078 |
| Molecular Formula | C15H11ClN6S2 |
| Molecular Weight | 374.88 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | 4-(2-amino-4-methyl-1,3-thiazol-5-yl)-N-(4-chloroanilino)-1,3-thiazole-2-carboximidoyl cyanide |
| SMILES | Cc1nc(N)sc1-c1csc(C(C#N)=NNc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C15H11ClN6S2/c1-8-13(24-15(18)19-8)12-7-23-14(20-12)11(6-17)22-21-10-4-2-9(16)3-5-10/h2-5,7,21H,1H3,(H2,18,19) |
| InChIKey | MFTSDXLPQUZDQR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 99.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.88 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|