C10H13F3N2OS — CID 87443114
2,2,2-trifluoro-1-(1-thia-4,7-diazacycloundec-9-yn-3-yl)ethanone (PubChem CID 87443114) has the molecular formula C10H13F3N2OS and a molecular weight of 266.29 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(1-thia-4,7-diazacycloundec-9-yn-3-yl)ethanone.
| Compound Name | 2,2,2-trifluoro-1-(1-thia-4,7-diazacycloundec-9-yn-3-yl)ethanone |
|---|---|
| PubChem CID | 87443114 |
| Molecular Formula | C10H13F3N2OS |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 2,2,2-trifluoro-1-(1-thia-4,7-diazacycloundec-9-yn-3-yl)ethanone |
| SMILES | O=C(C1CSCC#CCNCCN1)C(F)(F)F |
| InChI | InChI=1S/C10H13F3N2OS/c11-10(12,13)9(16)8-7-17-6-2-1-3-14-4-5-15-8/h8,14-15H,3-7H2 |
| InChIKey | PNZPVLXGLOYDPU-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|