C29H40O4 — CID 87443156
2-[1-[4-[2-[3,5-dimethyl-4-[1-(oxiran-2-yl)propoxy]phenyl]propan-2-yl]-2,6-dimethylphenoxy]propyl]oxirane (PubChem CID 87443156) has the molecular formula C29H40O4 and a molecular weight of 452.64 g/mol. Its IUPAC name is 2-[1-[4-[2-[3,5-dimethyl-4-[1-(oxiran-2-yl)propoxy]phenyl]propan-2-yl]-2,6-dimethylphenoxy]propyl]oxirane.
| Compound Name | 2-[1-[4-[2-[3,5-dimethyl-4-[1-(oxiran-2-yl)propoxy]phenyl]propan-2-yl]-2,6-dimethylphenoxy]propyl]oxirane |
|---|---|
| PubChem CID | 87443156 |
| Molecular Formula | C29H40O4 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | 2-[1-[4-[2-[3,5-dimethyl-4-[1-(oxiran-2-yl)propoxy]phenyl]propan-2-yl]-2,6-dimethylphenoxy]propyl]oxirane |
| SMILES | CCC(Oc1c(C)cc(C(C)(C)c2cc(C)c(OC(CC)C3CO3)c(C)c2)cc1C)C1CO1 |
| InChI | InChI=1S/C29H40O4/c1-9-23(25-15-30-25)32-27-17(3)11-21(12-18(27)4)29(7,8)22-13-19(5)28(20(6)14-22)33-24(10-2)26-16-31-26/h11-14,23-26H,9-10,15-16H2,1-8H3 |
| InChIKey | DPQYMTCMQSQCMH-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|