C40H66O — CID 87443185
(6E,10E,14E,16E,18E,22E,26E)-2,6,10,14,19,23,27,31-octamethyldotriaconta-6,10,14,16,18,22,26,30-octaen-2-ol (PubChem CID 87443185) has the molecular formula C40H66O and a molecular weight of 562.97 g/mol. Its IUPAC name is (6E,10E,14E,16E,18E,22E,26E)-2,6,10,14,19,23,27,31-octamethyldotriaconta-6,10,14,16,18,22,26,30-octaen-2-ol.
| Compound Name | (6E,10E,14E,16E,18E,22E,26E)-2,6,10,14,19,23,27,31-octamethyldotriaconta-6,10,14,16,18,22,26,30-octaen-2-ol |
|---|---|
| PubChem CID | 87443185 |
| Molecular Formula | C40H66O |
| Molecular Weight | 562.97 g/mol |
| Exact Mass | 562.51 |
| IUPAC Name | (6E,10E,14E,16E,18E,22E,26E)-2,6,10,14,19,23,27,31-octamethyldotriaconta-6,10,14,16,18,22,26,30-octaen-2-ol |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/C=C/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCCC(C)(C)O |
| InChI | InChI=1S/C40H66O/c1-33(2)19-13-22-36(5)25-16-28-37(6)26-14-23-34(3)20-11-12-21-35(4)24-15-27-38(7)29-17-30-39(8)31-18-32-40(9,10)41/h11-12,19-21,25-27,30,41H,13-18,22-24,28-29,31-32H2,1-10H3/b12-11+,34-20+,35-21+,36-25+,37-26+,38-27+,39-30+ |
| InChIKey | KBQFBNZDXFANLM-FECNPAFWSA-N |
| XLogP | 13.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.97 |
| LogP ≤ 5 | 13.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|