C28H39NO7S — CID 87443390
(1S,3S,7S,12S,16R)-7,11-dihydroxy-3-[2-(hydroxymethyl)-1,3-benzothiazol-5-yl]-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 87443390) has the molecular formula C28H39NO7S and a molecular weight of 533.69 g/mol. Its IUPAC name is (1S,3S,7S,12S,16R)-7,11-dihydroxy-3-[2-(hydroxymethyl)-1,3-benzothiazol-5-yl]-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (1S,3S,7S,12S,16R)-7,11-dihydroxy-3-[2-(hydroxymethyl)-1,3-benzothiazol-5-yl]-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 87443390 |
| Molecular Formula | C28H39NO7S |
| Molecular Weight | 533.69 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | (1S,3S,7S,12S,16R)-7,11-dihydroxy-3-[2-(hydroxymethyl)-1,3-benzothiazol-5-yl]-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | CC1C(=O)C(C)(C)[C@@H](O)CC(=O)O[C@H](c2ccc3sc(CO)nc3c2)C[C@@H]2O[C@]2(C)CCC[C@H](C)C1O |
| InChI | InChI=1S/C28H39NO7S/c1-15-7-6-10-28(5)22(36-28)12-19(17-8-9-20-18(11-17)29-23(14-30)37-20)35-24(32)13-21(31)27(3,4)26(34)16(2)25(15)33/h8-9,11,15-16,19,21-22,25,30-31,33H,6-7,10,12-14H2,1-5H3/t15-,16?,19-,21-,22-,25?,28+/m0/s1 |
| InChIKey | ZMKNYAULUIWSMH-YMTVBLBASA-N |
| XLogP | 4.08 |
| TPSA | 129.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.69 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|