C27H36O2 — CID 87443544
(2E,4E,6E,8E,10E,12E,14E)-15-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-4,9,13-trimethylpentadeca-2,4,6,8,10,12,14-heptaenal (PubChem CID 87443544) has the molecular formula C27H36O2 and a molecular weight of 392.58 g/mol. Its IUPAC name is (2E,4E,6E,8E,10E,12E,14E)-15-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-4,9,13-trimethylpentadeca-2,4,6,8,10,12,14-heptaenal.
| Compound Name | (2E,4E,6E,8E,10E,12E,14E)-15-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-4,9,13-trimethylpentadeca-2,4,6,8,10,12,14-heptaenal |
|---|---|
| PubChem CID | 87443544 |
| Molecular Formula | C27H36O2 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | (2E,4E,6E,8E,10E,12E,14E)-15-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-4,9,13-trimethylpentadeca-2,4,6,8,10,12,14-heptaenal |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=O)C(C)(C)CC(O)C1 |
| InChI | InChI=1S/C27H36O2/c1-21(11-7-8-12-22(2)15-10-18-28)13-9-14-23(3)16-17-26-24(4)19-25(29)20-27(26,5)6/h7-18,25,29H,19-20H2,1-6H3/b8-7+,13-9+,15-10+,17-16+,21-11+,22-12+,23-14+ |
| InChIKey | HQPQTQQUHPFUOA-JNOJMRGUSA-N |
| XLogP | 6.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|