About butane-2,3-dione;ethane-1,2-diol;ethoxyethane
butane-2,3-dione;ethane-1,2-diol;ethoxyethane (PubChem CID 87443771) has the molecular formula C10H22O5
and a molecular weight of 222.28 g/mol. Its IUPAC name is butane-2,3-dione;ethane-1,2-diol;ethoxyethane.
Molecular Properties
| Compound Name | butane-2,3-dione;ethane-1,2-diol;ethoxyethane |
| PubChem CID | 87443771 |
| Molecular Formula | C10H22O5 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | butane-2,3-dione;ethane-1,2-diol;ethoxyethane |
| SMILES | CC(=O)C(C)=O.CCOCC.OCCO |
| InChI | InChI=1S/C4H6O2.C4H10O.C2H6O2/c1-3(5)4(2)6;1-3-5-4-2;3-1-2-4/h1-2H3;3-4H2,1-2H3;3-4H,1-2H2 |
| InChIKey | XGYSYCHKJONCGR-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze butane-2,3-dione;ethane-1,2-diol;ethoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-2,3-dione;ethane-1,2-diol;ethoxyethane?
The IUPAC name of butane-2,3-dione;ethane-1,2-diol;ethoxyethane (CID 87443771) is butane-2,3-dione;ethane-1,2-diol;ethoxyethane.
What is the SMILES notation for butane-2,3-dione;ethane-1,2-diol;ethoxyethane?
The canonical SMILES for butane-2,3-dione;ethane-1,2-diol;ethoxyethane is CC(=O)C(C)=O.CCOCC.OCCO.
What is the InChIKey of butane-2,3-dione;ethane-1,2-diol;ethoxyethane?
The InChIKey is XGYSYCHKJONCGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2.C4H10O.C2H6O2/c1-3(5)4(2)6;1-3-5-4-2;3-1-2-4/h1-2H3;3-4H2,1-2H3;3-4H,1-2H2.
What are the key properties of butane-2,3-dione;ethane-1,2-diol;ethoxyethane?
butane-2,3-dione;ethane-1,2-diol;ethoxyethane has a molecular weight of 222.28 g/mol, XLogP of 0.18, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butane-2,3-dione;ethane-1,2-diol;ethoxyethane is sourced from PubChem (CID 87443771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).