C28H40ClNO6 — CID 87443884
3-(1-chloro-2-pyridin-2-ylethenyl)-10-ethyl-1,2-dihydroxy-8,8,12,16-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 87443884) has the molecular formula C28H40ClNO6 and a molecular weight of 522.08 g/mol. Its IUPAC name is 3-(1-chloro-2-pyridin-2-ylethenyl)-10-ethyl-1,2-dihydroxy-8,8,12,16-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | 3-(1-chloro-2-pyridin-2-ylethenyl)-10-ethyl-1,2-dihydroxy-8,8,12,16-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 87443884 |
| Molecular Formula | C28H40ClNO6 |
| Molecular Weight | 522.08 g/mol |
| Exact Mass | 521.25 |
| IUPAC Name | 3-(1-chloro-2-pyridin-2-ylethenyl)-10-ethyl-1,2-dihydroxy-8,8,12,16-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | CCC1CC(C)CCCC2(C)OC2(O)C(O)C(C(Cl)=Cc2ccccn2)OC(=O)CCC(C)(C)C1=O |
| InChI | InChI=1S/C28H40ClNO6/c1-6-19-16-18(2)10-9-13-27(5)28(34,36-27)25(33)23(21(29)17-20-11-7-8-15-30-20)35-22(31)12-14-26(3,4)24(19)32/h7-8,11,15,17-19,23,25,33-34H,6,9-10,12-14,16H2,1-5H3 |
| InChIKey | LPLONAOOHHBICC-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.08 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|