About 3-oxatricyclo[3.3.1.02,4]nonane
3-oxatricyclo[3.3.1.02,4]nonane (PubChem CID 87443945) has the molecular formula C8H12O
and a molecular weight of 124.18 g/mol. Its IUPAC name is 3-oxatricyclo[3.3.1.02,4]nonane.
Molecular Properties
| Compound Name | 3-oxatricyclo[3.3.1.02,4]nonane |
| PubChem CID | 87443945 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.18 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | 3-oxatricyclo[3.3.1.02,4]nonane |
| SMILES | C1CC2CC(C1)C1OC21 |
| InChI | InChI=1S/C8H12O/c1-2-5-4-6(3-1)8-7(5)9-8/h5-8H,1-4H2 |
| InChIKey | CXHFTDKGDIQRFJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.18 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-oxatricyclo[3.3.1.02,4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxatricyclo[3.3.1.02,4]nonane?
The IUPAC name of 3-oxatricyclo[3.3.1.02,4]nonane (CID 87443945) is 3-oxatricyclo[3.3.1.02,4]nonane.
What is the SMILES notation for 3-oxatricyclo[3.3.1.02,4]nonane?
The canonical SMILES for 3-oxatricyclo[3.3.1.02,4]nonane is C1CC2CC(C1)C1OC21.
What is the InChIKey of 3-oxatricyclo[3.3.1.02,4]nonane?
The InChIKey is CXHFTDKGDIQRFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O/c1-2-5-4-6(3-1)8-7(5)9-8/h5-8H,1-4H2.
What are the key properties of 3-oxatricyclo[3.3.1.02,4]nonane?
3-oxatricyclo[3.3.1.02,4]nonane has a molecular weight of 124.18 g/mol, XLogP of 1.57, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxatricyclo[3.3.1.02,4]nonane is sourced from PubChem (CID 87443945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).