C40H64O2 — CID 87443987
(6E,10E,14E,16E,18E,20E,22E,26E)-2,6,10,14,19,23,27,31-octamethyldotriaconta-6,10,14,16,18,20,22,26,30-nonaene-2,3-diol (PubChem CID 87443987) has the molecular formula C40H64O2 and a molecular weight of 576.95 g/mol. Its IUPAC name is (6E,10E,14E,16E,18E,20E,22E,26E)-2,6,10,14,19,23,27,31-octamethyldotriaconta-6,10,14,16,18,20,22,26,30-nonaene-2,3-diol.
| Compound Name | (6E,10E,14E,16E,18E,20E,22E,26E)-2,6,10,14,19,23,27,31-octamethyldotriaconta-6,10,14,16,18,20,22,26,30-nonaene-2,3-diol |
|---|---|
| PubChem CID | 87443987 |
| Molecular Formula | C40H64O2 |
| Molecular Weight | 576.95 g/mol |
| Exact Mass | 576.49 |
| IUPAC Name | (6E,10E,14E,16E,18E,20E,22E,26E)-2,6,10,14,19,23,27,31-octamethyldotriaconta-6,10,14,16,18,20,22,26,30-nonaene-2,3-diol |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C=C/C(C)=C/C=C/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC(O)C(C)(C)O |
| InChI | InChI=1S/C40H64O2/c1-32(2)18-13-21-35(5)24-16-27-36(6)25-14-22-33(3)19-11-12-20-34(4)23-15-26-37(7)28-17-29-38(8)30-31-39(41)40(9,10)42/h11-12,14,18-20,22,24-26,29,39,41-42H,13,15-17,21,23,27-28,30-31H2,1-10H3/b12-11+,22-14+,33-19+,34-20+,35-24+,36-25+,37-26+,38-29+ |
| InChIKey | LYGOWMNSQUUWMI-NOASVPEQSA-N |
| XLogP | 11.78 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.95 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|