C26H36O3 — CID 87444077
(2E,4E,6E,8E,10E,12E,14E)-19-methoxy-2,7,11,15,19-pentamethyl-16-oxoicosa-2,4,6,8,10,12,14-heptaenal (PubChem CID 87444077) has the molecular formula C26H36O3 and a molecular weight of 396.57 g/mol. Its IUPAC name is (2E,4E,6E,8E,10E,12E,14E)-19-methoxy-2,7,11,15,19-pentamethyl-16-oxoicosa-2,4,6,8,10,12,14-heptaenal.
| Compound Name | (2E,4E,6E,8E,10E,12E,14E)-19-methoxy-2,7,11,15,19-pentamethyl-16-oxoicosa-2,4,6,8,10,12,14-heptaenal |
|---|---|
| PubChem CID | 87444077 |
| Molecular Formula | C26H36O3 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | (2E,4E,6E,8E,10E,12E,14E)-19-methoxy-2,7,11,15,19-pentamethyl-16-oxoicosa-2,4,6,8,10,12,14-heptaenal |
| SMILES | COC(C)(C)CCC(=O)/C(C)=C/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(\C)C=O |
| InChI | InChI=1S/C26H36O3/c1-21(12-8-9-13-23(3)20-27)14-10-15-22(2)16-11-17-24(4)25(28)18-19-26(5,6)29-7/h8-17,20H,18-19H2,1-7H3/b9-8+,14-10+,16-11+,21-12+,22-15+,23-13+,24-17+ |
| InChIKey | UPQWPKXSLBUERR-IATSONSVSA-N |
| XLogP | 6.41 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|