C11H18F6O3Si — CID 87444095
3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluoro-3-(trifluoromethyl)butanoic acid (PubChem CID 87444095) has the molecular formula C11H18F6O3Si and a molecular weight of 340.34 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluoro-3-(trifluoromethyl)butanoic acid.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluoro-3-(trifluoromethyl)butanoic acid |
|---|---|
| PubChem CID | 87444095 |
| Molecular Formula | C11H18F6O3Si |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluoro-3-(trifluoromethyl)butanoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC(CC(=O)O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H18F6O3Si/c1-8(2,3)21(4,5)20-9(6-7(18)19,10(12,13)14)11(15,16)17/h6H2,1-5H3,(H,18,19) |
| InChIKey | OHWLMVHJQKMDAT-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|