C31H33N3O2 — CID 87444318
N-[(1R,9R,13S)-10-(cyclopropylmethyl)-1,13-dimethyl-5-nitro-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-4-yl]-1,1-diphenylmethanimine (PubChem CID 87444318) has the molecular formula C31H33N3O2 and a molecular weight of 479.62 g/mol. Its IUPAC name is N-[(1R,9R,13S)-10-(cyclopropylmethyl)-1,13-dimethyl-5-nitro-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-4-yl]-1,1-diphenylmethanimine.
| Compound Name | N-[(1R,9R,13S)-10-(cyclopropylmethyl)-1,13-dimethyl-5-nitro-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-4-yl]-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 87444318 |
| Molecular Formula | C31H33N3O2 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | N-[(1R,9R,13S)-10-(cyclopropylmethyl)-1,13-dimethyl-5-nitro-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-4-yl]-1,1-diphenylmethanimine |
| SMILES | C[C@@H]1[C@H]2Cc3cc([N+](=O)[O-])c(N=C(c4ccccc4)c4ccccc4)cc3[C@]1(C)CCN2CC1CC1 |
| InChI | InChI=1S/C31H33N3O2/c1-21-28-17-25-18-29(34(35)36)27(19-26(25)31(21,2)15-16-33(28)20-22-13-14-22)32-30(23-9-5-3-6-10-23)24-11-7-4-8-12-24/h3-12,18-19,21-22,28H,13-17,20H2,1-2H3/t21-,28-,31-/m1/s1 |
| InChIKey | FXWWEKCQHZUVPF-RHJQVBDDSA-N |
| XLogP | 6.70 |
| TPSA | 58.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|