About 1-(trifluoromethyl)-1,4-diazacycloundec-6-yn-2-one
1-(trifluoromethyl)-1,4-diazacycloundec-6-yn-2-one (PubChem CID 87444421) has the molecular formula C10H13F3N2O
and a molecular weight of 234.22 g/mol. Its IUPAC name is 1-(trifluoromethyl)-1,4-diazacycloundec-6-yn-2-one.
Molecular Properties
| Compound Name | 1-(trifluoromethyl)-1,4-diazacycloundec-6-yn-2-one |
| PubChem CID | 87444421 |
| Molecular Formula | C10H13F3N2O |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 1-(trifluoromethyl)-1,4-diazacycloundec-6-yn-2-one |
| SMILES | O=C1CNCC#CCCCCN1C(F)(F)F |
| InChI | InChI=1S/C10H13F3N2O/c11-10(12,13)15-7-5-3-1-2-4-6-14-8-9(15)16/h14H,1,3,5-8H2 |
| InChIKey | BPKNKYDQFXDFDU-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(trifluoromethyl)-1,4-diazacycloundec-6-yn-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(trifluoromethyl)-1,4-diazacycloundec-6-yn-2-one?
The IUPAC name of 1-(trifluoromethyl)-1,4-diazacycloundec-6-yn-2-one (CID 87444421) is 1-(trifluoromethyl)-1,4-diazacycloundec-6-yn-2-one.
What is the SMILES notation for 1-(trifluoromethyl)-1,4-diazacycloundec-6-yn-2-one?
The canonical SMILES for 1-(trifluoromethyl)-1,4-diazacycloundec-6-yn-2-one is O=C1CNCC#CCCCCN1C(F)(F)F.
What is the InChIKey of 1-(trifluoromethyl)-1,4-diazacycloundec-6-yn-2-one?
The InChIKey is BPKNKYDQFXDFDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F3N2O/c11-10(12,13)15-7-5-3-1-2-4-6-14-8-9(15)16/h14H,1,3,5-8H2.
What are the key properties of 1-(trifluoromethyl)-1,4-diazacycloundec-6-yn-2-one?
1-(trifluoromethyl)-1,4-diazacycloundec-6-yn-2-one has a molecular weight of 234.22 g/mol, XLogP of 1.11, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(trifluoromethyl)-1,4-diazacycloundec-6-yn-2-one is sourced from PubChem (CID 87444421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).