C37H41N5O6 — CID 87444554
[1-[3-[4-[[[(2S)-2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]methyl]anilino]-3-oxopropyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate (PubChem CID 87444554) has the molecular formula C37H41N5O6 and a molecular weight of 651.76 g/mol. Its IUPAC name is [1-[3-[4-[[[(2S)-2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]methyl]anilino]-3-oxopropyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate.
| Compound Name | [1-[3-[4-[[[(2S)-2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]methyl]anilino]-3-oxopropyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 87444554 |
| Molecular Formula | C37H41N5O6 |
| Molecular Weight | 651.76 g/mol |
| Exact Mass | 651.31 |
| IUPAC Name | [1-[3-[4-[[[(2S)-2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]methyl]anilino]-3-oxopropyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
| SMILES | O=CNc1cc([C@H](O)CNCc2ccc(NC(=O)CCN3CCC(OC(=O)Nc4ccccc4-c4ccccc4)CC3)cc2)ccc1O |
| InChI | InChI=1S/C37H41N5O6/c43-25-39-33-22-28(12-15-34(33)44)35(45)24-38-23-26-10-13-29(14-11-26)40-36(46)18-21-42-19-16-30(17-20-42)48-37(47)41-32-9-5-4-8-31(32)27-6-2-1-3-7-27/h1-15,22,25,30,35,38,44-45H,16-21,23-24H2,(H,39,43)(H,40,46)(H,41,47)/t35-/m1/s1 |
| InChIKey | IYLGFGHRVXEGOR-PGUFJCEWSA-N |
| XLogP | 5.49 |
| TPSA | 152.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.76 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|