C14H28N6O7S2 — CID 87444696
2-[(1-amino-2-methyl-1-prop-2-enyliminopropan-2-yl)diazenyl]-2-methyl-N'-prop-2-enylpropanimidamide;sulfo hydrogen sulfate (PubChem CID 87444696) has the molecular formula C14H28N6O7S2 and a molecular weight of 456.55 g/mol. Its IUPAC name is 2-[(1-amino-2-methyl-1-prop-2-enyliminopropan-2-yl)diazenyl]-2-methyl-N'-prop-2-enylpropanimidamide;sulfo hydrogen sulfate.
| Compound Name | 2-[(1-amino-2-methyl-1-prop-2-enyliminopropan-2-yl)diazenyl]-2-methyl-N'-prop-2-enylpropanimidamide;sulfo hydrogen sulfate |
|---|---|
| PubChem CID | 87444696 |
| Molecular Formula | C14H28N6O7S2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 2-[(1-amino-2-methyl-1-prop-2-enyliminopropan-2-yl)diazenyl]-2-methyl-N'-prop-2-enylpropanimidamide;sulfo hydrogen sulfate |
| SMILES | C=CC/N=C(\N)C(C)(C)/N=N/C(C)(C)/C(N)=N/CC=C.O=S(=O)(O)OS(=O)(=O)O |
| InChI | InChI=1S/C14H26N6.H2O7S2/c1-7-9-17-11(15)13(3,4)19-20-14(5,6)12(16)18-10-8-2;1-8(2,3)7-9(4,5)6/h7-8H,1-2,9-10H2,3-6H3,(H2,15,17)(H2,16,18);(H,1,2,3)(H,4,5,6)/b20-19+; |
| InChIKey | XCQDHQVWVSDFKJ-RZLHGTIFSA-N |
| XLogP | 0.69 |
| TPSA | 219.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|