C18H23ClN6O5S — CID 87444773
2-[4-[(4-chloro-5-ethyl-1H-imidazole-2-carbonyl)amino]-3-methoxypiperidin-1-yl]-4-[(Z)-methoxyiminomethyl]-1,3-thiazole-5-carboxylic acid (PubChem CID 87444773) has the molecular formula C18H23ClN6O5S and a molecular weight of 470.94 g/mol. Its IUPAC name is 2-[4-[(4-chloro-5-ethyl-1H-imidazole-2-carbonyl)amino]-3-methoxypiperidin-1-yl]-4-[(Z)-methoxyiminomethyl]-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-[4-[(4-chloro-5-ethyl-1H-imidazole-2-carbonyl)amino]-3-methoxypiperidin-1-yl]-4-[(Z)-methoxyiminomethyl]-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 87444773 |
| Molecular Formula | C18H23ClN6O5S |
| Molecular Weight | 470.94 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | 2-[4-[(4-chloro-5-ethyl-1H-imidazole-2-carbonyl)amino]-3-methoxypiperidin-1-yl]-4-[(Z)-methoxyiminomethyl]-1,3-thiazole-5-carboxylic acid |
| SMILES | CCc1[nH]c(C(=O)NC2CCN(c3nc(/C=N\OC)c(C(=O)O)s3)CC2OC)nc1Cl |
| InChI | InChI=1S/C18H23ClN6O5S/c1-4-9-14(19)24-15(21-9)16(26)22-10-5-6-25(8-12(10)29-2)18-23-11(7-20-30-3)13(31-18)17(27)28/h7,10,12H,4-6,8H2,1-3H3,(H,21,24)(H,22,26)(H,27,28)/b20-7- |
| InChIKey | HFSBJXGQJUAPDA-SCDVKCJHSA-N |
| XLogP | 1.78 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.94 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|