C11H21F3O3Si — CID 87445048
3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluoro-3-methylbutanoic acid (PubChem CID 87445048) has the molecular formula C11H21F3O3Si and a molecular weight of 286.37 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluoro-3-methylbutanoic acid.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluoro-3-methylbutanoic acid |
|---|---|
| PubChem CID | 87445048 |
| Molecular Formula | C11H21F3O3Si |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluoro-3-methylbutanoic acid |
| SMILES | CC(CC(=O)O)(O[Si](C)(C)C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C11H21F3O3Si/c1-9(2,3)18(5,6)17-10(4,7-8(15)16)11(12,13)14/h7H2,1-6H3,(H,15,16) |
| InChIKey | HUBFIOJVHGDIFD-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|