About 3-(2-amino-4-chloro-6-methylpyrimidin-5-yl)prop-2-ynylcarbamic acid;tert-butyl N-prop-2-ynylcarbamate
3-(2-amino-4-chloro-6-methylpyrimidin-5-yl)prop-2-ynylcarbamic acid;tert-butyl N-prop-2-ynylcarbamate (PubChem CID 87445345) has the molecular formula C17H22ClN5O4
and a molecular weight of 395.85 g/mol. Its IUPAC name is 3-(2-amino-4-chloro-6-methylpyrimidin-5-yl)prop-2-ynylcarbamic acid;tert-butyl N-prop-2-ynylcarbamate.
Molecular Properties
| Compound Name | 3-(2-amino-4-chloro-6-methylpyrimidin-5-yl)prop-2-ynylcarbamic acid;tert-butyl N-prop-2-ynylcarbamate |
| PubChem CID | 87445345 |
| Molecular Formula | C17H22ClN5O4 |
| Molecular Weight | 395.85 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 3-(2-amino-4-chloro-6-methylpyrimidin-5-yl)prop-2-ynylcarbamic acid;tert-butyl N-prop-2-ynylcarbamate |
| SMILES | C#CCNC(=O)OC(C)(C)C.Cc1nc(N)nc(Cl)c1C#CCNC(=O)O |
| InChI | InChI=1S/C9H9ClN4O2.C8H13NO2/c1-5-6(3-2-4-12-9(15)16)7(10)14-8(11)13-5;1-5-6-9-7(10)11-8(2,3)4/h12H,4H2,1H3,(H,15,16)(H2,11,13,14);1H,6H2,2-4H3,(H,9,10) |
| InChIKey | KFZABEKYZHHTTC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 139.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.85 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-amino-4-chloro-6-methylpyrimidin-5-yl)prop-2-ynylcarbamic acid;tert-butyl N-prop-2-ynylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-amino-4-chloro-6-methylpyrimidin-5-yl)prop-2-ynylcarbamic acid;tert-butyl N-prop-2-ynylcarbamate?
The IUPAC name of 3-(2-amino-4-chloro-6-methylpyrimidin-5-yl)prop-2-ynylcarbamic acid;tert-butyl N-prop-2-ynylcarbamate (CID 87445345) is 3-(2-amino-4-chloro-6-methylpyrimidin-5-yl)prop-2-ynylcarbamic acid;tert-butyl N-prop-2-ynylcarbamate.
What is the SMILES notation for 3-(2-amino-4-chloro-6-methylpyrimidin-5-yl)prop-2-ynylcarbamic acid;tert-butyl N-prop-2-ynylcarbamate?
The canonical SMILES for 3-(2-amino-4-chloro-6-methylpyrimidin-5-yl)prop-2-ynylcarbamic acid;tert-butyl N-prop-2-ynylcarbamate is C#CCNC(=O)OC(C)(C)C.Cc1nc(N)nc(Cl)c1C#CCNC(=O)O.
What is the InChIKey of 3-(2-amino-4-chloro-6-methylpyrimidin-5-yl)prop-2-ynylcarbamic acid;tert-butyl N-prop-2-ynylcarbamate?
The InChIKey is KFZABEKYZHHTTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClN4O2.C8H13NO2/c1-5-6(3-2-4-12-9(15)16)7(10)14-8(11)13-5;1-5-6-9-7(10)11-8(2,3)4/h12H,4H2,1H3,(H,15,16)(H2,11,13,14);1H,6H2,2-4H3,(H,9,10).
What are the key properties of 3-(2-amino-4-chloro-6-methylpyrimidin-5-yl)prop-2-ynylcarbamic acid;tert-butyl N-prop-2-ynylcarbamate?
3-(2-amino-4-chloro-6-methylpyrimidin-5-yl)prop-2-ynylcarbamic acid;tert-butyl N-prop-2-ynylcarbamate has a molecular weight of 395.85 g/mol, XLogP of 1.78, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-amino-4-chloro-6-methylpyrimidin-5-yl)prop-2-ynylcarbamic acid;tert-butyl N-prop-2-ynylcarbamate is sourced from PubChem (CID 87445345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).