C26H27N4O+ — CID 87445602
4-ethyl-3-[2-(3-ethyl-5,6-dimethyl-1,3-benzoxazol-2-ylidene)ethylidene]-1,2-dihydropyrrolo[1,2-a]benzimidazol-9-ium-6-carbonitrile (PubChem CID 87445602) has the molecular formula C26H27N4O+ and a molecular weight of 411.53 g/mol. Its IUPAC name is 4-ethyl-3-[2-(3-ethyl-5,6-dimethyl-1,3-benzoxazol-2-ylidene)ethylidene]-1,2-dihydropyrrolo[1,2-a]benzimidazol-9-ium-6-carbonitrile.
| Compound Name | 4-ethyl-3-[2-(3-ethyl-5,6-dimethyl-1,3-benzoxazol-2-ylidene)ethylidene]-1,2-dihydropyrrolo[1,2-a]benzimidazol-9-ium-6-carbonitrile |
|---|---|
| PubChem CID | 87445602 |
| Molecular Formula | C26H27N4O+ |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 4-ethyl-3-[2-(3-ethyl-5,6-dimethyl-1,3-benzoxazol-2-ylidene)ethylidene]-1,2-dihydropyrrolo[1,2-a]benzimidazol-9-ium-6-carbonitrile |
| SMILES | CCN1C(=CC=C2CC[n+]3c2n(CC)c2cc(C#N)ccc23)Oc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C26H27N4O/c1-5-28-23-13-17(3)18(4)14-24(23)31-25(28)10-8-20-11-12-30-21-9-7-19(16-27)15-22(21)29(6-2)26(20)30/h7-10,13-15H,5-6,11-12H2,1-4H3/q+1 |
| InChIKey | WAFZOJXTSCIQKR-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 45.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|