C9H20NO5+ — CID 87445785
trimethyl-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]azanium (PubChem CID 87445785) has the molecular formula C9H20NO5+ and a molecular weight of 222.26 g/mol. Its IUPAC name is trimethyl-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]azanium.
| Compound Name | trimethyl-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]azanium |
|---|---|
| PubChem CID | 87445785 |
| Molecular Formula | C9H20NO5+ |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | trimethyl-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]azanium |
| SMILES | C[N+](C)(C)[C@@H](C=O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H20NO5/c1-10(2,3)6(4-11)8(14)9(15)7(13)5-12/h4,6-9,12-15H,5H2,1-3H3/q+1/t6-,7+,8+,9+/m0/s1 |
| InChIKey | PTJJUDUQDZFPPS-JQCXWYLXSA-N |
| XLogP | -2.66 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|