About 1,6-dihydropyrido[1,2-a]indole
1,6-dihydropyrido[1,2-a]indole (PubChem CID 87445814) has the molecular formula C12H11N
and a molecular weight of 169.23 g/mol. Its IUPAC name is 1,6-dihydropyrido[1,2-a]indole.
Molecular Properties
| Compound Name | 1,6-dihydropyrido[1,2-a]indole |
| PubChem CID | 87445814 |
| Molecular Formula | C12H11N |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 1,6-dihydropyrido[1,2-a]indole |
| SMILES | C1=CCc2cc3n(c2=C1)CC=CC=3 |
| InChI | InChI=1S/C12H11N/c1-2-7-12-10(5-1)9-11-6-3-4-8-13(11)12/h1-4,6-7,9H,5,8H2 |
| InChIKey | VGICTOVREYFMSF-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,6-dihydropyrido[1,2-a]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dihydropyrido[1,2-a]indole?
The IUPAC name of 1,6-dihydropyrido[1,2-a]indole (CID 87445814) is 1,6-dihydropyrido[1,2-a]indole.
What is the SMILES notation for 1,6-dihydropyrido[1,2-a]indole?
The canonical SMILES for 1,6-dihydropyrido[1,2-a]indole is C1=CCc2cc3n(c2=C1)CC=CC=3.
What is the InChIKey of 1,6-dihydropyrido[1,2-a]indole?
The InChIKey is VGICTOVREYFMSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N/c1-2-7-12-10(5-1)9-11-6-3-4-8-13(11)12/h1-4,6-7,9H,5,8H2.
What are the key properties of 1,6-dihydropyrido[1,2-a]indole?
1,6-dihydropyrido[1,2-a]indole has a molecular weight of 169.23 g/mol, XLogP of 0.73, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dihydropyrido[1,2-a]indole is sourced from PubChem (CID 87445814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).