C30H36Cl2IN5O3S — CID 87446044
N-[4-[4-[2-(5,6-dichloro-1,3-diethylbenzimidazol-2-ylidene)ethylidene]-2,3-dihydro-1H-pyrido[1,2-a]benzimidazol-10-ium-5-yl]butylsulfonyl]acetamide iodide (PubChem CID 87446044) has the molecular formula C30H36Cl2IN5O3S and a molecular weight of 744.53 g/mol. Its IUPAC name is N-[4-[4-[2-(5,6-dichloro-1,3-diethylbenzimidazol-2-ylidene)ethylidene]-2,3-dihydro-1H-pyrido[1,2-a]benzimidazol-10-ium-5-yl]butylsulfonyl]acetamide iodide.
| Compound Name | N-[4-[4-[2-(5,6-dichloro-1,3-diethylbenzimidazol-2-ylidene)ethylidene]-2,3-dihydro-1H-pyrido[1,2-a]benzimidazol-10-ium-5-yl]butylsulfonyl]acetamide iodide |
|---|---|
| PubChem CID | 87446044 |
| Molecular Formula | C30H36Cl2IN5O3S |
| Molecular Weight | 744.53 g/mol |
| Exact Mass | 743.10 |
| IUPAC Name | N-[4-[4-[2-(5,6-dichloro-1,3-diethylbenzimidazol-2-ylidene)ethylidene]-2,3-dihydro-1H-pyrido[1,2-a]benzimidazol-10-ium-5-yl]butylsulfonyl]acetamide iodide |
| SMILES | CCN1C(=CC=C2CCC[n+]3c2n(CCCCS(=O)(=O)NC(C)=O)c2ccccc23)N(CC)c2cc(Cl)c(Cl)cc21.[I-] |
| InChI | InChI=1S/C30H35Cl2N5O3S.HI/c1-4-34-27-19-23(31)24(32)20-28(27)35(5-2)29(34)15-14-22-11-10-17-37-26-13-7-6-12-25(26)36(30(22)37)16-8-9-18-41(39,40)33-21(3)38;/h6-7,12-15,19-20H,4-5,8-11,16-18H2,1-3H3;1H |
| InChIKey | YXBOPYKZMYYRFW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.53 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|