About 1-(4-benzylpiperazin-1-yl)-2,2,2-trichloroethanone
1-(4-benzylpiperazin-1-yl)-2,2,2-trichloroethanone (PubChem CID 874461) has the molecular formula C13H15Cl3N2O
and a molecular weight of 321.63 g/mol. Its IUPAC name is 1-(4-benzylpiperazin-1-yl)-2,2,2-trichloroethanone.
Molecular Properties
| Compound Name | 1-(4-benzylpiperazin-1-yl)-2,2,2-trichloroethanone |
| PubChem CID | 874461 |
| Molecular Formula | C13H15Cl3N2O |
| Molecular Weight | 321.63 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 1-(4-benzylpiperazin-1-yl)-2,2,2-trichloroethanone |
| SMILES | O=C(N1CCN(Cc2ccccc2)CC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H15Cl3N2O/c14-13(15,16)12(19)18-8-6-17(7-9-18)10-11-4-2-1-3-5-11/h1-5H,6-10H2 |
| InChIKey | CENJRJRVFKKSLV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.63 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-benzylpiperazin-1-yl)-2,2,2-trichloroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-benzylpiperazin-1-yl)-2,2,2-trichloroethanone?
The IUPAC name of 1-(4-benzylpiperazin-1-yl)-2,2,2-trichloroethanone (CID 874461) is 1-(4-benzylpiperazin-1-yl)-2,2,2-trichloroethanone.
What is the SMILES notation for 1-(4-benzylpiperazin-1-yl)-2,2,2-trichloroethanone?
The canonical SMILES for 1-(4-benzylpiperazin-1-yl)-2,2,2-trichloroethanone is O=C(N1CCN(Cc2ccccc2)CC1)C(Cl)(Cl)Cl.
What is the InChIKey of 1-(4-benzylpiperazin-1-yl)-2,2,2-trichloroethanone?
The InChIKey is CENJRJRVFKKSLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15Cl3N2O/c14-13(15,16)12(19)18-8-6-17(7-9-18)10-11-4-2-1-3-5-11/h1-5H,6-10H2.
What are the key properties of 1-(4-benzylpiperazin-1-yl)-2,2,2-trichloroethanone?
1-(4-benzylpiperazin-1-yl)-2,2,2-trichloroethanone has a molecular weight of 321.63 g/mol, XLogP of 2.70, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-benzylpiperazin-1-yl)-2,2,2-trichloroethanone is sourced from PubChem (CID 874461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).