C19H21ClO7 — CID 87446204
[(1R)-2-(3-hydroxy-4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)ethyl] carbonochloridate (PubChem CID 87446204) has the molecular formula C19H21ClO7 and a molecular weight of 396.82 g/mol. Its IUPAC name is [(1R)-2-(3-hydroxy-4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)ethyl] carbonochloridate.
| Compound Name | [(1R)-2-(3-hydroxy-4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)ethyl] carbonochloridate |
|---|---|
| PubChem CID | 87446204 |
| Molecular Formula | C19H21ClO7 |
| Molecular Weight | 396.82 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | [(1R)-2-(3-hydroxy-4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)ethyl] carbonochloridate |
| SMILES | COc1ccc(C[C@@H](OC(=O)Cl)c2cc(OC)c(OC)c(OC)c2)cc1O |
| InChI | InChI=1S/C19H21ClO7/c1-23-14-6-5-11(7-13(14)21)8-15(27-19(20)22)12-9-16(24-2)18(26-4)17(10-12)25-3/h5-7,9-10,15,21H,8H2,1-4H3/t15-/m1/s1 |
| InChIKey | HHMMDRLEJDVFHM-OAHLLOKOSA-N |
| XLogP | 4.09 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.82 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|