C23H21ClN2O4S2 — CID 87446269
4-(2,3-dihydro-1H-pyrido[2,1-b][1,3]benzothiazol-10-ium-4-ylidenemethyl)-2,3-dihydro-1H-pyrido[2,1-b][1,3]benzothiazole perchlorate (PubChem CID 87446269) has the molecular formula C23H21ClN2O4S2 and a molecular weight of 489.02 g/mol. Its IUPAC name is 4-(2,3-dihydro-1H-pyrido[2,1-b][1,3]benzothiazol-10-ium-4-ylidenemethyl)-2,3-dihydro-1H-pyrido[2,1-b][1,3]benzothiazole perchlorate.
| Compound Name | 4-(2,3-dihydro-1H-pyrido[2,1-b][1,3]benzothiazol-10-ium-4-ylidenemethyl)-2,3-dihydro-1H-pyrido[2,1-b][1,3]benzothiazole perchlorate |
|---|---|
| PubChem CID | 87446269 |
| Molecular Formula | C23H21ClN2O4S2 |
| Molecular Weight | 489.02 g/mol |
| Exact Mass | 488.06 |
| IUPAC Name | 4-(2,3-dihydro-1H-pyrido[2,1-b][1,3]benzothiazol-10-ium-4-ylidenemethyl)-2,3-dihydro-1H-pyrido[2,1-b][1,3]benzothiazole perchlorate |
| SMILES | C(=C1CCC[n+]2c1sc1ccccc12)C1=C2Sc3ccccc3N2CCC1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C23H21N2S2.ClHO4/c1-3-11-20-18(9-1)24-13-5-7-16(22(24)26-20)15-17-8-6-14-25-19-10-2-4-12-21(19)27-23(17)25;2-1(3,4)5/h1-4,9-12,15H,5-8,13-14H2;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | HYIUVGNMBQEXJS-UHFFFAOYSA-M |
| XLogP | 1.23 |
| TPSA | 99.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.02 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|