About 2-(dimethylamino)-1,3-dimethylimidazol-1-ium-4-carbaldehyde
2-(dimethylamino)-1,3-dimethylimidazol-1-ium-4-carbaldehyde (PubChem CID 87448689) has the molecular formula C8H14N3O+
and a molecular weight of 168.22 g/mol. Its IUPAC name is 2-(dimethylamino)-1,3-dimethylimidazol-1-ium-4-carbaldehyde.
Molecular Properties
| Compound Name | 2-(dimethylamino)-1,3-dimethylimidazol-1-ium-4-carbaldehyde |
| PubChem CID | 87448689 |
| Molecular Formula | C8H14N3O+ |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.11 |
| IUPAC Name | 2-(dimethylamino)-1,3-dimethylimidazol-1-ium-4-carbaldehyde |
| SMILES | CN(C)c1n(C)c(C=O)c[n+]1C |
| InChI | InChI=1S/C8H14N3O/c1-9(2)8-10(3)5-7(6-12)11(8)4/h5-6H,1-4H3/q+1 |
| InChIKey | IJPDMSDWMDIHMI-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 29.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)-1,3-dimethylimidazol-1-ium-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)-1,3-dimethylimidazol-1-ium-4-carbaldehyde?
The IUPAC name of 2-(dimethylamino)-1,3-dimethylimidazol-1-ium-4-carbaldehyde (CID 87448689) is 2-(dimethylamino)-1,3-dimethylimidazol-1-ium-4-carbaldehyde.
What is the SMILES notation for 2-(dimethylamino)-1,3-dimethylimidazol-1-ium-4-carbaldehyde?
The canonical SMILES for 2-(dimethylamino)-1,3-dimethylimidazol-1-ium-4-carbaldehyde is CN(C)c1n(C)c(C=O)c[n+]1C.
What is the InChIKey of 2-(dimethylamino)-1,3-dimethylimidazol-1-ium-4-carbaldehyde?
The InChIKey is IJPDMSDWMDIHMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N3O/c1-9(2)8-10(3)5-7(6-12)11(8)4/h5-6H,1-4H3/q+1.
What are the key properties of 2-(dimethylamino)-1,3-dimethylimidazol-1-ium-4-carbaldehyde?
2-(dimethylamino)-1,3-dimethylimidazol-1-ium-4-carbaldehyde has a molecular weight of 168.22 g/mol, XLogP of -0.27, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)-1,3-dimethylimidazol-1-ium-4-carbaldehyde is sourced from PubChem (CID 87448689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).