About 2-(tetrabutyl-λ5-phosphanyl)acetaldehyde
2-(tetrabutyl-λ5-phosphanyl)acetaldehyde (PubChem CID 87449032) has the molecular formula C18H39OP
and a molecular weight of 302.48 g/mol. Its IUPAC name is 2-(tetrabutyl-λ5-phosphanyl)acetaldehyde.
Molecular Properties
| Compound Name | 2-(tetrabutyl-λ5-phosphanyl)acetaldehyde |
| PubChem CID | 87449032 |
| Molecular Formula | C18H39OP |
| Molecular Weight | 302.48 g/mol |
| Exact Mass | 302.27 |
| IUPAC Name | 2-(tetrabutyl-λ5-phosphanyl)acetaldehyde |
| SMILES | CCCCP(CC=O)(CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C18H39OP/c1-5-9-14-20(18-13-19,15-10-6-2,16-11-7-3)17-12-8-4/h13H,5-12,14-18H2,1-4H3 |
| InChIKey | YIFSJDCXTDGSFX-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 302.48 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(tetrabutyl-λ5-phosphanyl)acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(tetrabutyl-λ5-phosphanyl)acetaldehyde?
The IUPAC name of 2-(tetrabutyl-λ5-phosphanyl)acetaldehyde (CID 87449032) is 2-(tetrabutyl-λ5-phosphanyl)acetaldehyde.
What is the SMILES notation for 2-(tetrabutyl-λ5-phosphanyl)acetaldehyde?
The canonical SMILES for 2-(tetrabutyl-λ5-phosphanyl)acetaldehyde is CCCCP(CC=O)(CCCC)(CCCC)CCCC.
What is the InChIKey of 2-(tetrabutyl-λ5-phosphanyl)acetaldehyde?
The InChIKey is YIFSJDCXTDGSFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H39OP/c1-5-9-14-20(18-13-19,15-10-6-2,16-11-7-3)17-12-8-4/h13H,5-12,14-18H2,1-4H3.
What are the key properties of 2-(tetrabutyl-λ5-phosphanyl)acetaldehyde?
2-(tetrabutyl-λ5-phosphanyl)acetaldehyde has a molecular weight of 302.48 g/mol, XLogP of 5.94, 14 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(tetrabutyl-λ5-phosphanyl)acetaldehyde is sourced from PubChem (CID 87449032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).