C11H21NO3 — CID 87449116
1,3-diethoxy-2-(ethoxymethyl)-2-isocyanopropane (PubChem CID 87449116) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is 1,3-diethoxy-2-(ethoxymethyl)-2-isocyanopropane.
| Compound Name | 1,3-diethoxy-2-(ethoxymethyl)-2-isocyanopropane |
|---|---|
| PubChem CID | 87449116 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 1,3-diethoxy-2-(ethoxymethyl)-2-isocyanopropane |
| SMILES | [C-]#[N+]C(COCC)(COCC)COCC |
| InChI | InChI=1S/C11H21NO3/c1-5-13-8-11(12-4,9-14-6-2)10-15-7-3/h5-10H2,1-3H3 |
| InChIKey | JZMKPPJKYCQCTO-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 32.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|