C36H39N3O6S — CID 87449364
17-cyclohexyl-13-[[2-morpholin-4-yl-5-(2-oxopyrrolidin-1-yl)phenyl]methoxy]-9-oxa-3-thia-5-azatetracyclo[9.6.0.02,7.012,16]heptadeca-1(17),2(7),4,10,13,15-hexaene-4-carboxylic acid (PubChem CID 87449364) has the molecular formula C36H39N3O6S and a molecular weight of 641.79 g/mol. Its IUPAC name is 17-cyclohexyl-13-[[2-morpholin-4-yl-5-(2-oxopyrrolidin-1-yl)phenyl]methoxy]-9-oxa-3-thia-5-azatetracyclo[9.6.0.02,7.012,16]heptadeca-1(17),2(7),4,10,13,15-hexaene-4-carboxylic acid.
| Compound Name | 17-cyclohexyl-13-[[2-morpholin-4-yl-5-(2-oxopyrrolidin-1-yl)phenyl]methoxy]-9-oxa-3-thia-5-azatetracyclo[9.6.0.02,7.012,16]heptadeca-1(17),2(7),4,10,13,15-hexaene-4-carboxylic acid |
|---|---|
| PubChem CID | 87449364 |
| Molecular Formula | C36H39N3O6S |
| Molecular Weight | 641.79 g/mol |
| Exact Mass | 641.26 |
| IUPAC Name | 17-cyclohexyl-13-[[2-morpholin-4-yl-5-(2-oxopyrrolidin-1-yl)phenyl]methoxy]-9-oxa-3-thia-5-azatetracyclo[9.6.0.02,7.012,16]heptadeca-1(17),2(7),4,10,13,15-hexaene-4-carboxylic acid |
| SMILES | O=C(O)C1=NCC2=C(S1)C1=C(C3CCCCC3)C3=CC=C(OCc4cc(N5CCCC5=O)ccc4N4CCOCC4)C3C1=COC2 |
| InChI | InChI=1S/C36H39N3O6S/c40-30-7-4-12-39(30)25-8-10-28(38-13-15-43-16-14-38)23(17-25)20-45-29-11-9-26-31(22-5-2-1-3-6-22)33-27(32(26)29)21-44-19-24-18-37-35(36(41)42)46-34(24)33/h8-11,17,21-22,32H,1-7,12-16,18-20H2,(H,41,42) |
| InChIKey | UDDDUNVISJCYKE-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.79 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|