C28H38BrN3O5S — CID 87449383
[2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-[3-(4-sulfamoylphenoxy)propyl]azanium bromide (PubChem CID 87449383) has the molecular formula C28H38BrN3O5S and a molecular weight of 608.60 g/mol. Its IUPAC name is [2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-[3-(4-sulfamoylphenoxy)propyl]azanium bromide.
| Compound Name | [2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-[3-(4-sulfamoylphenoxy)propyl]azanium bromide |
|---|---|
| PubChem CID | 87449383 |
| Molecular Formula | C28H38BrN3O5S |
| Molecular Weight | 608.60 g/mol |
| Exact Mass | 607.17 |
| IUPAC Name | [2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-[3-(4-sulfamoylphenoxy)propyl]azanium bromide |
| SMILES | C[N+](C)(CCCOc1ccc(S(N)(=O)=O)cc1)Cc1cnc([C@](O)(c2ccccc2)C2CCCCC2)o1.[Br-] |
| InChI | InChI=1S/C28H38N3O5S.BrH/c1-31(2,18-9-19-35-24-14-16-26(17-15-24)37(29,33)34)21-25-20-30-27(36-25)28(32,22-10-5-3-6-11-22)23-12-7-4-8-13-23;/h3,5-6,10-11,14-17,20,23,32H,4,7-9,12-13,18-19,21H2,1-2H3,(H2,29,33,34);1H/q+1;/p-1/t28-;/m0./s1 |
| InChIKey | ZTUQNALRGZSXNT-JCOPYZAKSA-M |
| XLogP | 1.19 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.60 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|