About (6E)-8-butoxy-3,6-dimethylocta-1,6-diene
(6E)-8-butoxy-3,6-dimethylocta-1,6-diene (PubChem CID 87449611) has the molecular formula C14H26O
and a molecular weight of 210.36 g/mol. Its IUPAC name is (6E)-8-butoxy-3,6-dimethylocta-1,6-diene.
Molecular Properties
| Compound Name | (6E)-8-butoxy-3,6-dimethylocta-1,6-diene |
| PubChem CID | 87449611 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | (6E)-8-butoxy-3,6-dimethylocta-1,6-diene |
| SMILES | C=CC(C)CC/C(C)=C/COCCCC |
| InChI | InChI=1S/C14H26O/c1-5-7-11-15-12-10-14(4)9-8-13(3)6-2/h6,10,13H,2,5,7-9,11-12H2,1,3-4H3/b14-10+ |
| InChIKey | AZAHPDHGIKUOGD-GXDHUFHOSA-N |
| XLogP | 4.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6E)-8-butoxy-3,6-dimethylocta-1,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E)-8-butoxy-3,6-dimethylocta-1,6-diene?
The IUPAC name of (6E)-8-butoxy-3,6-dimethylocta-1,6-diene (CID 87449611) is (6E)-8-butoxy-3,6-dimethylocta-1,6-diene.
What is the SMILES notation for (6E)-8-butoxy-3,6-dimethylocta-1,6-diene?
The canonical SMILES for (6E)-8-butoxy-3,6-dimethylocta-1,6-diene is C=CC(C)CC/C(C)=C/COCCCC.
What is the InChIKey of (6E)-8-butoxy-3,6-dimethylocta-1,6-diene?
The InChIKey is AZAHPDHGIKUOGD-GXDHUFHOSA-N. The full InChI is InChI=1S/C14H26O/c1-5-7-11-15-12-10-14(4)9-8-13(3)6-2/h6,10,13H,2,5,7-9,11-12H2,1,3-4H3/b14-10+.
What are the key properties of (6E)-8-butoxy-3,6-dimethylocta-1,6-diene?
(6E)-8-butoxy-3,6-dimethylocta-1,6-diene has a molecular weight of 210.36 g/mol, XLogP of 4.35, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-8-butoxy-3,6-dimethylocta-1,6-diene is sourced from PubChem (CID 87449611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).