C23H44O7 — CID 87449864
2,3-di(butanoyloxy)propyl butanoate;octan-1-ol (PubChem CID 87449864) has the molecular formula C23H44O7 and a molecular weight of 432.60 g/mol. Its IUPAC name is 2,3-di(butanoyloxy)propyl butanoate;octan-1-ol.
| Compound Name | 2,3-di(butanoyloxy)propyl butanoate;octan-1-ol |
|---|---|
| PubChem CID | 87449864 |
| Molecular Formula | C23H44O7 |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.31 |
| IUPAC Name | 2,3-di(butanoyloxy)propyl butanoate;octan-1-ol |
| SMILES | CCCC(=O)OCC(COC(=O)CCC)OC(=O)CCC.CCCCCCCCO |
| InChI | InChI=1S/C15H26O6.C8H18O/c1-4-7-13(16)19-10-12(21-15(18)9-6-3)11-20-14(17)8-5-2;1-2-3-4-5-6-7-8-9/h12H,4-11H2,1-3H3;9H,2-8H2,1H3 |
| InChIKey | WJWQXXXADPKCNI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|